C10H9N3O7 — CID 155683066
4-(2,4-dinitroanilino)-3-oxobutanoic acid (PubChem CID 155683066) has the molecular formula C10H9N3O7 and a molecular weight of 283.20 g/mol. Its IUPAC name is 4-(2,4-dinitroanilino)-3-oxobutanoic acid.
| Compound Name | 4-(2,4-dinitroanilino)-3-oxobutanoic acid |
|---|---|
| PubChem CID | 155683066 |
| Molecular Formula | C10H9N3O7 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 4-(2,4-dinitroanilino)-3-oxobutanoic acid |
| SMILES | O=C(O)CC(=O)CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N3O7/c14-7(4-10(15)16)5-11-8-2-1-6(12(17)18)3-9(8)13(19)20/h1-3,11H,4-5H2,(H,15,16) |
| InChIKey | LWBGUIUYAUODIU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|