C17H16N4O7 — CID 170439782
(2S)-2-[[2-(2,4-dinitroanilino)acetyl]amino]-3-phenylpropanoic acid (PubChem CID 170439782) has the molecular formula C17H16N4O7 and a molecular weight of 388.34 g/mol. Its IUPAC name is (2S)-2-[[2-(2,4-dinitroanilino)acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-(2,4-dinitroanilino)acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 170439782 |
| Molecular Formula | C17H16N4O7 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (2S)-2-[[2-(2,4-dinitroanilino)acetyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H16N4O7/c22-16(19-14(17(23)24)8-11-4-2-1-3-5-11)10-18-13-7-6-12(20(25)26)9-15(13)21(27)28/h1-7,9,14,18H,8,10H2,(H,19,22)(H,23,24)/t14-/m0/s1 |
| InChIKey | LMSCSNARNPVPFN-AWEZNQCLSA-N |
| XLogP | 1.73 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|