C19H20N4O8 — CID 3697302
methyl 2-[[2-(2,4-dinitroanilino)-3-hydroxypropanoyl]amino]-3-phenylpropanoate (PubChem CID 3697302) has the molecular formula C19H20N4O8 and a molecular weight of 432.39 g/mol. Its IUPAC name is methyl 2-[[2-(2,4-dinitroanilino)-3-hydroxypropanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[2-(2,4-dinitroanilino)-3-hydroxypropanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 3697302 |
| Molecular Formula | C19H20N4O8 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | methyl 2-[[2-(2,4-dinitroanilino)-3-hydroxypropanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)C(CO)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N4O8/c1-31-19(26)15(9-12-5-3-2-4-6-12)21-18(25)16(11-24)20-14-8-7-13(22(27)28)10-17(14)23(29)30/h2-8,10,15-16,20,24H,9,11H2,1H3,(H,21,25) |
| InChIKey | JNPDFZKLVBIOEH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|