C16H22N4O7 — CID 610925
methyl 2-[2-(2,4-dinitroanilino)propanoylamino]-4-methylpentanoate (PubChem CID 610925) has the molecular formula C16H22N4O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is methyl 2-[2-(2,4-dinitroanilino)propanoylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[2-(2,4-dinitroanilino)propanoylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 610925 |
| Molecular Formula | C16H22N4O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | methyl 2-[2-(2,4-dinitroanilino)propanoylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)C(C)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N4O7/c1-9(2)7-13(16(22)27-4)18-15(21)10(3)17-12-6-5-11(19(23)24)8-14(12)20(25)26/h5-6,8-10,13,17H,7H2,1-4H3,(H,18,21) |
| InChIKey | BWZLPMXSQVIFQS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|