C10H10ClN3O5 — CID 62727735
3-chloro-N-(2,4-dinitrophenyl)-2-methylpropanamide (PubChem CID 62727735) has the molecular formula C10H10ClN3O5 and a molecular weight of 287.66 g/mol. Its IUPAC name is 3-chloro-N-(2,4-dinitrophenyl)-2-methylpropanamide.
| Compound Name | 3-chloro-N-(2,4-dinitrophenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 62727735 |
| Molecular Formula | C10H10ClN3O5 |
| Molecular Weight | 287.66 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3-chloro-N-(2,4-dinitrophenyl)-2-methylpropanamide |
| SMILES | CC(CCl)C(=O)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10ClN3O5/c1-6(5-11)10(15)12-8-3-2-7(13(16)17)4-9(8)14(18)19/h2-4,6H,5H2,1H3,(H,12,15) |
| InChIKey | WYDLOLLDCUONBV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.66 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|