C7H5N5O7 — CID 12548690
1-(2,4-dinitrophenyl)-3-nitrourea (PubChem CID 12548690) has the molecular formula C7H5N5O7 and a molecular weight of 271.15 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-3-nitrourea.
| Compound Name | 1-(2,4-dinitrophenyl)-3-nitrourea |
|---|---|
| PubChem CID | 12548690 |
| Molecular Formula | C7H5N5O7 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-3-nitrourea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])N[N+](=O)[O-] |
| InChI | InChI=1S/C7H5N5O7/c13-7(9-12(18)19)8-5-2-1-4(10(14)15)3-6(5)11(16)17/h1-3H,(H2,8,9,13) |
| InChIKey | OCSJLKWIUYHFSL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 170.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|