C9H7N3O7 — CID 5251417
methyl 2-(2,4-dinitroanilino)-2-oxoacetate (PubChem CID 5251417) has the molecular formula C9H7N3O7 and a molecular weight of 269.17 g/mol. Its IUPAC name is methyl 2-(2,4-dinitroanilino)-2-oxoacetate.
| Compound Name | methyl 2-(2,4-dinitroanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 5251417 |
| Molecular Formula | C9H7N3O7 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | methyl 2-(2,4-dinitroanilino)-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7N3O7/c1-19-9(14)8(13)10-6-3-2-5(11(15)16)4-7(6)12(17)18/h2-4H,1H3,(H,10,13) |
| InChIKey | IQXSSSDDKNABMQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|