C13H12N4O8 — CID 23265733
dimethyl (E,4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]pent-2-enedioate (PubChem CID 23265733) has the molecular formula C13H12N4O8 and a molecular weight of 352.26 g/mol. Its IUPAC name is dimethyl (E,4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]pent-2-enedioate.
| Compound Name | dimethyl (E,4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]pent-2-enedioate |
|---|---|
| PubChem CID | 23265733 |
| Molecular Formula | C13H12N4O8 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | dimethyl (E,4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]pent-2-enedioate |
| SMILES | COC(=O)/C=C/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)OC |
| InChI | InChI=1S/C13H12N4O8/c1-24-12(18)6-5-10(13(19)25-2)15-14-9-4-3-8(16(20)21)7-11(9)17(22)23/h3-7,14H,1-2H3/b6-5+,15-10- |
| InChIKey | MYSSXLZQTMTKMY-VSDXDJRBSA-N |
| XLogP | 1.17 |
| TPSA | 163.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|