C11H14N4O5 — CID 13440229
(3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-2-methylbutan-2-ol (PubChem CID 13440229) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is (3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-2-methylbutan-2-ol.
| Compound Name | (3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 13440229 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-2-methylbutan-2-ol |
| SMILES | C/C(=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(C)(C)O |
| InChI | InChI=1S/C11H14N4O5/c1-7(11(2,3)16)12-13-9-5-4-8(14(17)18)6-10(9)15(19)20/h4-6,13,16H,1-3H3/b12-7+ |
| InChIKey | XOJFZLKVQXIHLL-KPKJPENVSA-N |
| XLogP | 2.06 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|