C28H22F2N8O8 — CID 139082946
N-[(E)-1-(4-fluorophenyl)ethylideneamino]-2,4-dinitroaniline (PubChem CID 139082946) has the molecular formula C28H22F2N8O8 and a molecular weight of 636.53 g/mol. Its IUPAC name is N-[(E)-1-(4-fluorophenyl)ethylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-1-(4-fluorophenyl)ethylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 139082946 |
| Molecular Formula | C28H22F2N8O8 |
| Molecular Weight | 636.53 g/mol |
| Exact Mass | 636.15 |
| IUPAC Name | N-[(E)-1-(4-fluorophenyl)ethylideneamino]-2,4-dinitroaniline |
| SMILES | C/C(=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(F)cc1.C/C(=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/2C14H11FN4O4/c2*1-9(10-2-4-11(15)5-3-10)16-17-13-7-6-12(18(20)21)8-14(13)19(22)23/h2*2-8,17H,1H3/b2*16-9+ |
| InChIKey | HZDMVAYATZHPPL-PKZWEOMDSA-N |
| XLogP | 6.96 |
| TPSA | 221.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.53 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|