C18H19N5O5 — CID 5035188
N-[1-(4-morpholin-4-ylphenyl)ethylideneamino]-2,4-dinitroaniline (PubChem CID 5035188) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is N-[1-(4-morpholin-4-ylphenyl)ethylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[1-(4-morpholin-4-ylphenyl)ethylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 5035188 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[1-(4-morpholin-4-ylphenyl)ethylideneamino]-2,4-dinitroaniline |
| SMILES | CC(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H19N5O5/c1-13(14-2-4-15(5-3-14)21-8-10-28-11-9-21)19-20-17-7-6-16(22(24)25)12-18(17)23(26)27/h2-7,12,20H,8-11H2,1H3 |
| InChIKey | HJJIZWQTUAOAGA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|