C21H22N6O5S — CID 93057868
N-[(E)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline (PubChem CID 93057868) has the molecular formula C21H22N6O5S and a molecular weight of 470.51 g/mol. Its IUPAC name is N-[(E)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline.
| Compound Name | N-[(E)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 93057868 |
| Molecular Formula | C21H22N6O5S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N-[(E)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| SMILES | C/C(=N\Nc1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-])c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C21H22N6O5S/c1-16(17-2-4-18(5-3-17)25-9-8-22-15-25)23-24-20-7-6-19(14-21(20)27(28)29)33(30,31)26-10-12-32-13-11-26/h2-9,14-15,24H,10-13H2,1H3/b23-16+ |
| InChIKey | XIBAOWGBPUNURV-XQNSMLJCSA-N |
| XLogP | 2.64 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|