C17H24N4O5S — CID 7529719
N-[(Z)-[(3S)-3-methylcyclohexylidene]amino]-4-morpholin-4-ylsulfonyl-2-nitroaniline (PubChem CID 7529719) has the molecular formula C17H24N4O5S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[(Z)-[(3S)-3-methylcyclohexylidene]amino]-4-morpholin-4-ylsulfonyl-2-nitroaniline.
| Compound Name | N-[(Z)-[(3S)-3-methylcyclohexylidene]amino]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 7529719 |
| Molecular Formula | C17H24N4O5S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-[(Z)-[(3S)-3-methylcyclohexylidene]amino]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| SMILES | C[C@H]1CCC/C(=N/Nc2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H24N4O5S/c1-13-3-2-4-14(11-13)18-19-16-6-5-15(12-17(16)21(22)23)27(24,25)20-7-9-26-10-8-20/h5-6,12-13,19H,2-4,7-11H2,1H3/b18-14-/t13-/m0/s1 |
| InChIKey | CDPLGSNGHSKBNZ-SSICXYGWSA-N |
| XLogP | 2.59 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|