C17H16Cl2N4O5S — CID 5113890
N-[(2,6-dichlorophenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline (PubChem CID 5113890) has the molecular formula C17H16Cl2N4O5S and a molecular weight of 459.31 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline.
| Compound Name | N-[(2,6-dichlorophenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 5113890 |
| Molecular Formula | C17H16Cl2N4O5S |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCOCC2)ccc1NN=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H16Cl2N4O5S/c18-14-2-1-3-15(19)13(14)11-20-21-16-5-4-12(10-17(16)23(24)25)29(26,27)22-6-8-28-9-7-22/h1-5,10-11,21H,6-9H2 |
| InChIKey | LJCWJJAFABJBMS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|