C19H22N4O5S — CID 5029807
N-[(2,4-dimethylphenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline (PubChem CID 5029807) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline.
| Compound Name | N-[(2,4-dimethylphenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 5029807 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| SMILES | Cc1ccc(C=NNc2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C19H22N4O5S/c1-14-3-4-16(15(2)11-14)13-20-21-18-6-5-17(12-19(18)23(24)25)29(26,27)22-7-9-28-10-8-22/h3-6,11-13,21H,7-10H2,1-2H3 |
| InChIKey | YMGDVVBPHJELAB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|