C17H17BrN4O5S — CID 6073543
N-[(Z)-(3-bromophenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline (PubChem CID 6073543) has the molecular formula C17H17BrN4O5S and a molecular weight of 469.32 g/mol. Its IUPAC name is N-[(Z)-(3-bromophenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline.
| Compound Name | N-[(Z)-(3-bromophenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 6073543 |
| Molecular Formula | C17H17BrN4O5S |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | N-[(Z)-(3-bromophenyl)methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCOCC2)ccc1N/N=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C17H17BrN4O5S/c18-14-3-1-2-13(10-14)12-19-20-16-5-4-15(11-17(16)22(23)24)28(25,26)21-6-8-27-9-7-21/h1-5,10-12,20H,6-9H2/b19-12- |
| InChIKey | BKWMXJJLEAGIGJ-UNOMPAQXSA-N |
| XLogP | 2.82 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|