C18H21N5O7S — CID 4214543
5-(hydroxymethyl)-2-methyl-4-[[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)hydrazinylidene]methyl]pyridin-3-ol (PubChem CID 4214543) has the molecular formula C18H21N5O7S and a molecular weight of 451.46 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-4-[[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)hydrazinylidene]methyl]pyridin-3-ol.
| Compound Name | 5-(hydroxymethyl)-2-methyl-4-[[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)hydrazinylidene]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 4214543 |
| Molecular Formula | C18H21N5O7S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-4-[[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)hydrazinylidene]methyl]pyridin-3-ol |
| SMILES | Cc1ncc(CO)c(C=NNc2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H21N5O7S/c1-12-18(25)15(13(11-24)9-19-12)10-20-21-16-3-2-14(8-17(16)23(26)27)31(28,29)22-4-6-30-7-5-22/h2-3,8-10,21,24-25H,4-7,11H2,1H3 |
| InChIKey | UWBXGCZVYABFOJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 167.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|