C18H21N5O5S — CID 3282087
4-[2-[1-(4-morpholin-4-ylphenyl)ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 3282087) has the molecular formula C18H21N5O5S and a molecular weight of 419.46 g/mol. Its IUPAC name is 4-[2-[1-(4-morpholin-4-ylphenyl)ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[1-(4-morpholin-4-ylphenyl)ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3282087 |
| Molecular Formula | C18H21N5O5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 4-[2-[1-(4-morpholin-4-ylphenyl)ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | CC(=NNc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H21N5O5S/c1-13(14-2-4-15(5-3-14)22-8-10-28-11-9-22)20-21-17-7-6-16(29(19,26)27)12-18(17)23(24)25/h2-7,12,21H,8-11H2,1H3,(H2,19,26,27) |
| InChIKey | DTWCLMMTNCKPHB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|