C14H11Cl3N4O4S — CID 6073544
3-nitro-4-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]benzenesulfonamide (PubChem CID 6073544) has the molecular formula C14H11Cl3N4O4S and a molecular weight of 437.69 g/mol. Its IUPAC name is 3-nitro-4-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | 3-nitro-4-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6073544 |
| Molecular Formula | C14H11Cl3N4O4S |
| Molecular Weight | 437.69 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | 3-nitro-4-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]benzenesulfonamide |
| SMILES | C/C(=N/Nc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H11Cl3N4O4S/c1-7(9-3-4-10(15)14(17)13(9)16)19-20-11-5-2-8(26(18,24)25)6-12(11)21(22)23/h2-6,20H,1H3,(H2,18,24,25)/b19-7- |
| InChIKey | PPVJICCASBSGCU-GXHLCREISA-N |
| XLogP | 4.04 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.69 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|