C15H14F2N4O5S — CID 6071909
4-[(2Z)-2-[1-[4-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 6071909) has the molecular formula C15H14F2N4O5S and a molecular weight of 400.36 g/mol. Its IUPAC name is 4-[(2Z)-2-[1-[4-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2Z)-2-[1-[4-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6071909 |
| Molecular Formula | C15H14F2N4O5S |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 4-[(2Z)-2-[1-[4-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | C/C(=N/Nc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H14F2N4O5S/c1-9(10-2-4-11(5-3-10)26-15(16)17)19-20-13-7-6-12(27(18,24)25)8-14(13)21(22)23/h2-8,15,20H,1H3,(H2,18,24,25)/b19-9- |
| InChIKey | BDUMNMJYSZDUIO-OCKHKDLRSA-N |
| XLogP | 2.68 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|