C19H22F2N4O5S — CID 3976552
2-[2-[1-[4-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]-N,N-diethyl-5-nitrobenzenesulfonamide (PubChem CID 3976552) has the molecular formula C19H22F2N4O5S and a molecular weight of 456.47 g/mol. Its IUPAC name is 2-[2-[1-[4-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]-N,N-diethyl-5-nitrobenzenesulfonamide.
| Compound Name | 2-[2-[1-[4-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]-N,N-diethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3976552 |
| Molecular Formula | C19H22F2N4O5S |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-[2-[1-[4-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]-N,N-diethyl-5-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1NN=C(C)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H22F2N4O5S/c1-4-24(5-2)31(28,29)18-12-15(25(26)27)8-11-17(18)23-22-13(3)14-6-9-16(10-7-14)30-19(20)21/h6-12,19,23H,4-5H2,1-3H3 |
| InChIKey | FLBFVGLWNMDGHJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|