C21H28N4O7S — CID 46803816
N,N-diethyl-5-nitro-2-[(2E)-2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]benzenesulfonamide (PubChem CID 46803816) has the molecular formula C21H28N4O7S and a molecular weight of 480.54 g/mol. Its IUPAC name is N,N-diethyl-5-nitro-2-[(2E)-2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-5-nitro-2-[(2E)-2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46803816 |
| Molecular Formula | C21H28N4O7S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | N,N-diethyl-5-nitro-2-[(2E)-2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1N/N=C(\C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H28N4O7S/c1-7-24(8-2)33(28,29)20-13-16(25(26)27)9-10-17(20)23-22-14(3)15-11-18(30-4)21(32-6)19(12-15)31-5/h9-13,23H,7-8H2,1-6H3/b22-14+ |
| InChIKey | PXFSGFAYCQVXNZ-HYARGMPZSA-N |
| XLogP | 3.49 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|