C24H26N4O8S — CID 4164524
N-(2-methoxyphenyl)-3-nitro-4-[2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]benzenesulfonamide (PubChem CID 4164524) has the molecular formula C24H26N4O8S and a molecular weight of 530.56 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3-nitro-4-[2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyphenyl)-3-nitro-4-[2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4164524 |
| Molecular Formula | C24H26N4O8S |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | N-(2-methoxyphenyl)-3-nitro-4-[2-[1-(3,4,5-trimethoxyphenyl)ethylidene]hydrazinyl]benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(NN=C(C)c2cc(OC)c(OC)c(OC)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H26N4O8S/c1-15(16-12-22(34-3)24(36-5)23(13-16)35-4)25-26-18-11-10-17(14-20(18)28(29)30)37(31,32)27-19-8-6-7-9-21(19)33-2/h6-14,26-27H,1-5H3 |
| InChIKey | GFQYPAFWCCBHCK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|