C22H22N4O7S — CID 6281117
4-[(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide (PubChem CID 6281117) has the molecular formula C22H22N4O7S and a molecular weight of 486.51 g/mol. Its IUPAC name is 4-[(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6281117 |
| Molecular Formula | C22H22N4O7S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 4-[(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(/C=N\Nc2ccc(S(=O)(=O)Nc3ccccc3OC)cc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C22H22N4O7S/c1-31-16-9-8-15(22(12-16)33-3)14-23-24-18-11-10-17(13-20(18)26(27)28)34(29,30)25-19-6-4-5-7-21(19)32-2/h4-14,24-25H,1-3H3/b23-14- |
| InChIKey | SDYLJPNJQVGJRL-UCQKPKSFSA-N |
| XLogP | 3.87 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|