C20H16Cl2N4O5S — CID 3502448
4-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide (PubChem CID 3502448) has the molecular formula C20H16Cl2N4O5S and a molecular weight of 495.34 g/mol. Its IUPAC name is 4-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3502448 |
| Molecular Formula | C20H16Cl2N4O5S |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | 4-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(NN=Cc2ccc(Cl)c(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16Cl2N4O5S/c1-31-20-5-3-2-4-18(20)25-32(29,30)14-7-9-17(19(11-14)26(27)28)24-23-12-13-6-8-15(21)16(22)10-13/h2-12,24-25H,1H3 |
| InChIKey | CXKWNELZLHOZTC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|