C24H21N7O7S2 — CID 4830838
N-(2-methoxyphenyl)-4-[2-[[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 4830838) has the molecular formula C24H21N7O7S2 and a molecular weight of 583.61 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-[2-[[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(2-methoxyphenyl)-4-[2-[[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4830838 |
| Molecular Formula | C24H21N7O7S2 |
| Molecular Weight | 583.61 g/mol |
| Exact Mass | 583.09 |
| IUPAC Name | N-(2-methoxyphenyl)-4-[2-[[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(NN=Cc2ccc(Sc3nccn3C)c([N+](=O)[O-])c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H21N7O7S2/c1-29-12-11-25-24(29)39-23-10-7-16(13-21(23)31(34)35)15-26-27-18-9-8-17(14-20(18)30(32)33)40(36,37)28-19-5-3-4-6-22(19)38-2/h3-15,27-28H,1-2H3 |
| InChIKey | LYUJFKBSIXHINL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 183.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|