C21H23N7O6S2 — CID 98071319
N,N-diethyl-2-[(2Z)-2-[[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 98071319) has the molecular formula C21H23N7O6S2 and a molecular weight of 533.59 g/mol. Its IUPAC name is N,N-diethyl-2-[(2Z)-2-[[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-2-[(2Z)-2-[[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 98071319 |
| Molecular Formula | C21H23N7O6S2 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | N,N-diethyl-2-[(2Z)-2-[[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1N/N=C\c1ccc(Sc2nccn2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N7O6S2/c1-4-26(5-2)36(33,34)20-13-16(27(29)30)7-8-17(20)24-23-14-15-6-9-19(18(12-15)28(31)32)35-21-22-10-11-25(21)3/h6-14,24H,4-5H2,1-3H3/b23-14- |
| InChIKey | MYWRMPSGZZBBKZ-UCQKPKSFSA-N |
| XLogP | 3.86 |
| TPSA | 165.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|