C32H33N7O7S2 — CID 99658625
(3R)-N,N-diethyl-1-[5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]phenyl]sulfonylpiperidine-3-carboxamide (PubChem CID 99658625) has the molecular formula C32H33N7O7S2 and a molecular weight of 691.79 g/mol. Its IUPAC name is (3R)-N,N-diethyl-1-[5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]phenyl]sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N,N-diethyl-1-[5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]phenyl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 99658625 |
| Molecular Formula | C32H33N7O7S2 |
| Molecular Weight | 691.79 g/mol |
| Exact Mass | 691.19 |
| IUPAC Name | (3R)-N,N-diethyl-1-[5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]phenyl]sulfonylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CCCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2N/N=C\c2ccc(Sc3cccc4cccnc34)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C32H33N7O7S2/c1-3-36(4-2)32(40)24-10-7-17-37(21-24)48(45,46)30-19-25(38(41)42)13-14-26(30)35-34-20-22-12-15-28(27(18-22)39(43)44)47-29-11-5-8-23-9-6-16-33-31(23)29/h5-6,8-9,11-16,18-20,24,35H,3-4,7,10,17,21H2,1-2H3/b34-20-/t24-/m1/s1 |
| InChIKey | GAYMUBOGSKIVNV-UDDRSKGWSA-N |
| XLogP | 5.92 |
| TPSA | 181.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.79 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|