C27H37N7O7S — CID 98053648
1-[2-[(2Z)-2-[[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 98053648) has the molecular formula C27H37N7O7S and a molecular weight of 603.70 g/mol. Its IUPAC name is 1-[2-[(2Z)-2-[[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(2Z)-2-[[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 98053648 |
| Molecular Formula | C27H37N7O7S |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | 1-[2-[(2Z)-2-[[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)CN(CC(C)C)c1ccc(/C=N\Nc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCC(C(N)=O)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H37N7O7S/c1-18(2)16-31(17-19(3)4)24-8-5-20(13-25(24)34(38)39)15-29-30-23-7-6-22(33(36)37)14-26(23)42(40,41)32-11-9-21(10-12-32)27(28)35/h5-8,13-15,18-19,21,30H,9-12,16-17H2,1-4H3,(H2,28,35)/b29-15- |
| InChIKey | GVENIJRTOBVOEG-FDVSRXAVSA-N |
| XLogP | 3.95 |
| TPSA | 194.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|