C26H24N6O7S3 — CID 99656558
N-[(Z)-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitroaniline (PubChem CID 99656558) has the molecular formula C26H24N6O7S3 and a molecular weight of 628.71 g/mol. Its IUPAC name is N-[(Z)-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitroaniline.
| Compound Name | N-[(Z)-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 99656558 |
| Molecular Formula | C26H24N6O7S3 |
| Molecular Weight | 628.71 g/mol |
| Exact Mass | 628.09 |
| IUPAC Name | N-[(Z)-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitroaniline |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2N/N=C\c2ccc(Sc3nc4ccccc4s3)c([N+](=O)[O-])c2)C[C@H](C)O1 |
| InChI | InChI=1S/C26H24N6O7S3/c1-16-14-30(15-17(2)39-16)42(37,38)25-12-19(31(33)34)8-9-21(25)29-27-13-18-7-10-24(22(11-18)32(35)36)41-26-28-20-5-3-4-6-23(20)40-26/h3-13,16-17,29H,14-15H2,1-2H3/b27-13-/t16-,17+ |
| InChIKey | CAVYUWFWUFKHIQ-YEXULKNISA-N |
| XLogP | 5.51 |
| TPSA | 170.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.71 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|