C26H22N6O7S2 — CID 124530195
2-morpholin-4-ylsulfonyl-4-nitro-N-[(Z)-(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylideneamino]aniline (PubChem CID 124530195) has the molecular formula C26H22N6O7S2 and a molecular weight of 594.63 g/mol. Its IUPAC name is 2-morpholin-4-ylsulfonyl-4-nitro-N-[(Z)-(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylideneamino]aniline.
| Compound Name | 2-morpholin-4-ylsulfonyl-4-nitro-N-[(Z)-(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 124530195 |
| Molecular Formula | C26H22N6O7S2 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | 2-morpholin-4-ylsulfonyl-4-nitro-N-[(Z)-(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylideneamino]aniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\c2ccc(Sc3cccc4cccnc34)c([N+](=O)[O-])c2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C26H22N6O7S2/c33-31(34)20-7-8-21(25(16-20)41(37,38)30-11-13-39-14-12-30)29-28-17-18-6-9-23(22(15-18)32(35)36)40-24-5-1-3-19-4-2-10-27-26(19)24/h1-10,15-17,29H,11-14H2/b28-17- |
| InChIKey | AESDVLSCVLVWCB-QRQIAZFYSA-N |
| XLogP | 4.67 |
| TPSA | 170.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|