C15H16N4O5S2 — CID 42995165
2-morpholin-4-ylsulfonyl-4-nitro-N-[(E)-thiophen-3-ylmethylideneamino]aniline (PubChem CID 42995165) has the molecular formula C15H16N4O5S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-morpholin-4-ylsulfonyl-4-nitro-N-[(E)-thiophen-3-ylmethylideneamino]aniline.
| Compound Name | 2-morpholin-4-ylsulfonyl-4-nitro-N-[(E)-thiophen-3-ylmethylideneamino]aniline |
|---|---|
| PubChem CID | 42995165 |
| Molecular Formula | C15H16N4O5S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2-morpholin-4-ylsulfonyl-4-nitro-N-[(E)-thiophen-3-ylmethylideneamino]aniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2ccsc2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H16N4O5S2/c20-19(21)13-1-2-14(17-16-10-12-3-8-25-11-12)15(9-13)26(22,23)18-4-6-24-7-5-18/h1-3,8-11,17H,4-7H2/b16-10+ |
| InChIKey | MZSBHWFCAGNMDU-MHWRWJLKSA-N |
| XLogP | 2.12 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|