C26H26N4O8S — CID 6512634
methyl 4-[[4-[(Z)-[(2-morpholin-4-ylsulfonyl-4-nitrophenyl)hydrazinylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 6512634) has the molecular formula C26H26N4O8S and a molecular weight of 554.58 g/mol. Its IUPAC name is methyl 4-[[4-[(Z)-[(2-morpholin-4-ylsulfonyl-4-nitrophenyl)hydrazinylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[4-[(Z)-[(2-morpholin-4-ylsulfonyl-4-nitrophenyl)hydrazinylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 6512634 |
| Molecular Formula | C26H26N4O8S |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | methyl 4-[[4-[(Z)-[(2-morpholin-4-ylsulfonyl-4-nitrophenyl)hydrazinylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccc(/C=N\Nc3ccc([N+](=O)[O-])cc3S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O8S/c1-36-26(31)21-6-2-20(3-7-21)18-38-23-9-4-19(5-10-23)17-27-28-24-11-8-22(30(32)33)16-25(24)39(34,35)29-12-14-37-15-13-29/h2-11,16-17,28H,12-15,18H2,1H3/b27-17- |
| InChIKey | UYKLPQQETSNEMK-PKAZHMFMSA-N |
| XLogP | 3.43 |
| TPSA | 149.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|