C17H17N5O7S — CID 3910260
2-morpholin-4-ylsulfonyl-4-nitro-N-[(2-nitrophenyl)methylideneamino]aniline (PubChem CID 3910260) has the molecular formula C17H17N5O7S and a molecular weight of 435.42 g/mol. Its IUPAC name is 2-morpholin-4-ylsulfonyl-4-nitro-N-[(2-nitrophenyl)methylideneamino]aniline.
| Compound Name | 2-morpholin-4-ylsulfonyl-4-nitro-N-[(2-nitrophenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 3910260 |
| Molecular Formula | C17H17N5O7S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 2-morpholin-4-ylsulfonyl-4-nitro-N-[(2-nitrophenyl)methylideneamino]aniline |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2ccccc2[N+](=O)[O-])c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H17N5O7S/c23-21(24)14-5-6-15(17(11-14)30(27,28)20-7-9-29-10-8-20)19-18-12-13-3-1-2-4-16(13)22(25)26/h1-6,11-12,19H,7-10H2 |
| InChIKey | AOYSYQWSZKFDKI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|