C19H22N4O5S — CID 137172687
2-[(Z)-[[2-(azepan-1-ylsulfonyl)-4-nitrophenyl]hydrazinylidene]methyl]phenol (PubChem CID 137172687) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is 2-[(Z)-[[2-(azepan-1-ylsulfonyl)-4-nitrophenyl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-[(Z)-[[2-(azepan-1-ylsulfonyl)-4-nitrophenyl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 137172687 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-[(Z)-[[2-(azepan-1-ylsulfonyl)-4-nitrophenyl]hydrazinylidene]methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\c2ccccc2O)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C19H22N4O5S/c24-18-8-4-3-7-15(18)14-20-21-17-10-9-16(23(25)26)13-19(17)29(27,28)22-11-5-1-2-6-12-22/h3-4,7-10,13-14,21,24H,1-2,5-6,11-12H2/b20-14- |
| InChIKey | FXLLQAYQVNPRSE-ZHZULCJRSA-N |
| XLogP | 3.31 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|