C15H16N6O7S — CID 137172508
6-hydroxy-5-[[(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)hydrazinylidene]methyl]-1H-pyrimidine-2,4-dione (PubChem CID 137172508) has the molecular formula C15H16N6O7S and a molecular weight of 424.40 g/mol. Its IUPAC name is 6-hydroxy-5-[[(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)hydrazinylidene]methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[[(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)hydrazinylidene]methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137172508 |
| Molecular Formula | C15H16N6O7S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 6-hydroxy-5-[[(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)hydrazinylidene]methyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(C=NNc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H16N6O7S/c22-13-10(14(23)18-15(24)17-13)8-16-19-11-4-3-9(21(25)26)7-12(11)29(27,28)20-5-1-2-6-20/h3-4,7-8,19H,1-2,5-6H2,(H3,17,18,22,23,24) |
| InChIKey | ZJUCWIYLDJKAAF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 190.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|