C17H22N6O7S — CID 137172506
N-butyl-N-ethyl-2-[2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 137172506) has the molecular formula C17H22N6O7S and a molecular weight of 454.47 g/mol. Its IUPAC name is N-butyl-N-ethyl-2-[2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N-butyl-N-ethyl-2-[2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 137172506 |
| Molecular Formula | C17H22N6O7S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-butyl-N-ethyl-2-[2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | CCCCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1NN=Cc1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H22N6O7S/c1-3-5-8-22(4-2)31(29,30)14-9-11(23(27)28)6-7-13(14)21-18-10-12-15(24)19-17(26)20-16(12)25/h6-7,9-10,21H,3-5,8H2,1-2H3,(H3,19,20,24,25,26) |
| InChIKey | ZHERAVKBHLOSLF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 190.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|