C17H20N6O8S — CID 137172517
5-[[[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitrophenyl]hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 137172517) has the molecular formula C17H20N6O8S and a molecular weight of 468.45 g/mol. Its IUPAC name is 5-[[[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitrophenyl]hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[[[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitrophenyl]hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137172517 |
| Molecular Formula | C17H20N6O8S |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 5-[[[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitrophenyl]hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2NN=Cc2c(O)[nH]c(=O)[nH]c2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C17H20N6O8S/c1-9-7-22(8-10(2)31-9)32(29,30)14-5-11(23(27)28)3-4-13(14)21-18-6-12-15(24)19-17(26)20-16(12)25/h3-6,9-10,21H,7-8H2,1-2H3,(H3,19,20,24,25,26)/t9-,10-/m0/s1 |
| InChIKey | PWQJKFJEDMBTOK-UWVGGRQHSA-N |
| XLogP | -0.08 |
| TPSA | 200.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|