C23H23N7O9S — CID 137035005
5-[[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]sulfonyl-4-nitrophenyl]hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 137035005) has the molecular formula C23H23N7O9S and a molecular weight of 573.54 g/mol. Its IUPAC name is 5-[[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]sulfonyl-4-nitrophenyl]hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]sulfonyl-4-nitrophenyl]hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137035005 |
| Molecular Formula | C23H23N7O9S |
| Molecular Weight | 573.54 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | 5-[[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]sulfonyl-4-nitrophenyl]hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(C=NNc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C23H23N7O9S/c31-21-16(22(32)26-23(33)25-21)11-24-27-17-3-2-15(30(34)35)10-20(17)40(36,37)29-7-5-28(6-8-29)12-14-1-4-18-19(9-14)39-13-38-18/h1-4,9-11,27H,5-8,12-13H2,(H3,25,26,31,32,33) |
| InChIKey | ZNWZOIQFLLXPAB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 212.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.54 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|