C31H37N7O8S — CID 99658036
2-[(2Z)-2-[[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]methylidene]hydrazinyl]-N-butyl-N-ethyl-5-nitrobenzenesulfonamide (PubChem CID 99658036) has the molecular formula C31H37N7O8S and a molecular weight of 667.75 g/mol. Its IUPAC name is 2-[(2Z)-2-[[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]methylidene]hydrazinyl]-N-butyl-N-ethyl-5-nitrobenzenesulfonamide.
| Compound Name | 2-[(2Z)-2-[[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]methylidene]hydrazinyl]-N-butyl-N-ethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 99658036 |
| Molecular Formula | C31H37N7O8S |
| Molecular Weight | 667.75 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | 2-[(2Z)-2-[[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]methylidene]hydrazinyl]-N-butyl-N-ethyl-5-nitrobenzenesulfonamide |
| SMILES | CCCCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1N/N=C\c1ccc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H37N7O8S/c1-3-5-12-36(4-2)47(43,44)31-19-25(37(39)40)8-9-26(31)33-32-20-23-6-10-27(28(17-23)38(41)42)35-15-13-34(14-16-35)21-24-7-11-29-30(18-24)46-22-45-29/h6-11,17-20,33H,3-5,12-16,21-22H2,1-2H3/b32-20- |
| InChIKey | UNUSJZCFQPZSSR-RGXNXFOYSA-N |
| XLogP | 4.81 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.75 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|