C19H25N5O5S2 — CID 6145031
N,N-diethyl-2-[(2Z)-2-[(5-morpholin-4-ylthiophen-2-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 6145031) has the molecular formula C19H25N5O5S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N,N-diethyl-2-[(2Z)-2-[(5-morpholin-4-ylthiophen-2-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-2-[(2Z)-2-[(5-morpholin-4-ylthiophen-2-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6145031 |
| Molecular Formula | C19H25N5O5S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N,N-diethyl-2-[(2Z)-2-[(5-morpholin-4-ylthiophen-2-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1N/N=C\c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C19H25N5O5S2/c1-3-23(4-2)31(27,28)18-13-15(24(25)26)5-7-17(18)21-20-14-16-6-8-19(30-16)22-9-11-29-12-10-22/h5-8,13-14,21H,3-4,9-12H2,1-2H3/b20-14- |
| InChIKey | MMZUYWAGFXMOPR-ZHZULCJRSA-N |
| XLogP | 2.97 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|