C16H15F3N4O3S — CID 4147907
N-[(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 4147907) has the molecular formula C16H15F3N4O3S and a molecular weight of 400.38 g/mol. Its IUPAC name is N-[(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 4147907 |
| Molecular Formula | C16H15F3N4O3S |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-[(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NN=Cc1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C16H15F3N4O3S/c17-16(18,19)11-1-3-13(14(9-11)23(24)25)21-20-10-12-2-4-15(27-12)22-5-7-26-8-6-22/h1-4,9-10,21H,5-8H2 |
| InChIKey | HWDZHFCOFMDGOO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|