C19H19F3N4O4 — CID 126237051
N-[(E)-(2-methoxy-4-morpholin-4-ylphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126237051) has the molecular formula C19H19F3N4O4 and a molecular weight of 424.38 g/mol. Its IUPAC name is N-[(E)-(2-methoxy-4-morpholin-4-ylphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(E)-(2-methoxy-4-morpholin-4-ylphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126237051 |
| Molecular Formula | C19H19F3N4O4 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-[(E)-(2-methoxy-4-morpholin-4-ylphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | COc1cc(N2CCOCC2)ccc1/C=N/Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19F3N4O4/c1-29-18-11-15(25-6-8-30-9-7-25)4-2-13(18)12-23-24-16-5-3-14(19(20,21)22)10-17(16)26(27)28/h2-5,10-12,24H,6-9H2,1H3/b23-12+ |
| InChIKey | GPVUMQXKYHUKKE-FSJBWODESA-N |
| XLogP | 3.90 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|