C15H9F6N3O2 — CID 5165965
2-nitro-4-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]aniline (PubChem CID 5165965) has the molecular formula C15H9F6N3O2 and a molecular weight of 377.24 g/mol. Its IUPAC name is 2-nitro-4-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]aniline.
| Compound Name | 2-nitro-4-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 5165965 |
| Molecular Formula | C15H9F6N3O2 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-nitro-4-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NN=Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H9F6N3O2/c16-14(17,18)10-5-6-12(13(7-10)24(25)26)23-22-8-9-3-1-2-4-11(9)15(19,20)21/h1-8,23H |
| InChIKey | TVOMOCIVIATQNB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|