C22H16F4N4O4 — CID 126114427
N-(4-fluorophenyl)-2-[2-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetamide (PubChem CID 126114427) has the molecular formula C22H16F4N4O4 and a molecular weight of 476.39 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126114427 |
| Molecular Formula | C22H16F4N4O4 |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1/C=N\Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H16F4N4O4/c23-16-6-8-17(9-7-16)28-21(31)13-34-20-4-2-1-3-14(20)12-27-29-18-10-5-15(22(24,25)26)11-19(18)30(32)33/h1-12,29H,13H2,(H,28,31)/b27-12- |
| InChIKey | VKPZPGCRYYWTGS-PPDIBHTLSA-N |
| XLogP | 5.22 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|