C23H18F4N4O5 — CID 126075903
N-(4-fluorophenyl)-2-[2-methoxy-6-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetamide (PubChem CID 126075903) has the molecular formula C23H18F4N4O5 and a molecular weight of 506.41 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-methoxy-6-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-methoxy-6-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126075903 |
| Molecular Formula | C23H18F4N4O5 |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-methoxy-6-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetamide |
| SMILES | COc1cccc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H18F4N4O5/c1-35-20-4-2-3-14(22(20)36-13-21(32)29-17-8-6-16(24)7-9-17)12-28-30-18-10-5-15(23(25,26)27)11-19(18)31(33)34/h2-12,30H,13H2,1H3,(H,29,32)/b28-12- |
| InChIKey | LFMFKDOVEXFYCO-NVJOKUIPSA-N |
| XLogP | 5.22 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|