C19H17BrF3N3O6 — CID 126112428
methyl 2-[2-bromo-6-ethoxy-4-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126112428) has the molecular formula C19H17BrF3N3O6 and a molecular weight of 520.26 g/mol. Its IUPAC name is methyl 2-[2-bromo-6-ethoxy-4-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-6-ethoxy-4-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126112428 |
| Molecular Formula | C19H17BrF3N3O6 |
| Molecular Weight | 520.26 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | methyl 2-[2-bromo-6-ethoxy-4-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc(Br)c1OCC(=O)OC |
| InChI | InChI=1S/C19H17BrF3N3O6/c1-3-31-16-7-11(6-13(20)18(16)32-10-17(27)30-2)9-24-25-14-5-4-12(19(21,22)23)8-15(14)26(28)29/h4-9,25H,3,10H2,1-2H3/b24-9- |
| InChIKey | KUPXTOXMBWTCMW-OPVMPGTRSA-N |
| XLogP | 4.77 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|