C21H13Br2F3N4O5 — CID 126101338
N-[(Z)-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126101338) has the molecular formula C21H13Br2F3N4O5 and a molecular weight of 618.16 g/mol. Its IUPAC name is N-[(Z)-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126101338 |
| Molecular Formula | C21H13Br2F3N4O5 |
| Molecular Weight | 618.16 g/mol |
| Exact Mass | 615.92 |
| IUPAC Name | N-[(Z)-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cccc(COc2c(Br)cc(/C=N\Nc3ccc(C(F)(F)F)cc3[N+](=O)[O-])cc2Br)c1 |
| InChI | InChI=1S/C21H13Br2F3N4O5/c22-16-7-13(8-17(23)20(16)35-11-12-2-1-3-15(6-12)29(31)32)10-27-28-18-5-4-14(21(24,25)26)9-19(18)30(33)34/h1-10,28H,11H2/b27-10- |
| InChIKey | ASNYWOXBLGSQJW-NCAUGAEKSA-N |
| XLogP | 7.07 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.16 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|