C16H10BrF3IN3O5 — CID 126080552
2-[2-bromo-6-iodo-4-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 126080552) has the molecular formula C16H10BrF3IN3O5 and a molecular weight of 588.07 g/mol. Its IUPAC name is 2-[2-bromo-6-iodo-4-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-iodo-4-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126080552 |
| Molecular Formula | C16H10BrF3IN3O5 |
| Molecular Weight | 588.07 g/mol |
| Exact Mass | 586.88 |
| IUPAC Name | 2-[2-bromo-6-iodo-4-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1I |
| InChI | InChI=1S/C16H10BrF3IN3O5/c17-10-3-8(4-11(21)15(10)29-7-14(25)26)6-22-23-12-2-1-9(16(18,19)20)5-13(12)24(27)28/h1-6,23H,7H2,(H,25,26)/b22-6- |
| InChIKey | SJTQCVXZWVMVHK-HCDFXORVSA-N |
| XLogP | 4.89 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.07 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|