C21H12Cl2F3I2N3O3 — CID 126075899
N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126075899) has the molecular formula C21H12Cl2F3I2N3O3 and a molecular weight of 736.05 g/mol. Its IUPAC name is N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126075899 |
| Molecular Formula | C21H12Cl2F3I2N3O3 |
| Molecular Weight | 736.05 g/mol |
| Exact Mass | 734.83 |
| IUPAC Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1N/N=C\c1cc(I)c(OCc2ccc(Cl)cc2Cl)c(I)c1 |
| InChI | InChI=1S/C21H12Cl2F3I2N3O3/c22-14-3-1-12(15(23)8-14)10-34-20-16(27)5-11(6-17(20)28)9-29-30-18-4-2-13(21(24,25)26)7-19(18)31(32)33/h1-9,30H,10H2/b29-9- |
| InChIKey | DFNOZMGLQIQFCM-JNNAGZRYSA-N |
| XLogP | 8.15 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.05 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|